C28H31NO7 — CID 162985123
(2R,3S)-11-(2-hydroxyethoxy)-2-(4-hydroxy-3-methoxyphenyl)-3-(methylaminomethoxy)-3,4,5,6-tetrahydro-2H-naphtho[2,1-f]chromen-8-ol (PubChem CID 162985123) has the molecular formula C28H31NO7 and a molecular weight of 493.56 g/mol. Its IUPAC name is (2R,3S)-11-(2-hydroxyethoxy)-2-(4-hydroxy-3-methoxyphenyl)-3-(methylaminomethoxy)-3,4,5,6-tetrahydro-2H-naphtho[2,1-f]chromen-8-ol.
| Compound Name | (2R,3S)-11-(2-hydroxyethoxy)-2-(4-hydroxy-3-methoxyphenyl)-3-(methylaminomethoxy)-3,4,5,6-tetrahydro-2H-naphtho[2,1-f]chromen-8-ol |
|---|---|
| PubChem CID | 162985123 |
| Molecular Formula | C28H31NO7 |
| Molecular Weight | 493.56 g/mol |
| Exact Mass | 493.21 |
| IUPAC Name | (2R,3S)-11-(2-hydroxyethoxy)-2-(4-hydroxy-3-methoxyphenyl)-3-(methylaminomethoxy)-3,4,5,6-tetrahydro-2H-naphtho[2,1-f]chromen-8-ol |
| SMILES | CNCO[C@H]1Cc2c(cc(OCCO)c3c2CCc2cc(O)ccc2-3)O[C@@H]1c1ccc(O)c(OC)c1 |
| InChI | InChI=1S/C28H31NO7/c1-29-15-35-26-13-21-20-6-3-16-11-18(31)5-7-19(16)27(20)25(34-10-9-30)14-23(21)36-28(26)17-4-8-22(32)24(12-17)33-2/h4-5,7-8,11-12,14,26,28-32H,3,6,9-10,13,15H2,1-2H3/t26-,28+/m0/s1 |
| InChIKey | JGIGRYFBKDEAIP-XTEPFMGCSA-N |
| XLogP | 3.48 |
| TPSA | 109.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.56 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|