C43H48N2O8 — CID 162827752
2-[[3-[(cyclohexylamino)methoxy]-8-hydroxy-2-(4-hydroxy-3-methoxyphenyl)-6-(1H-indol-5-ylmethyl)-3,4,5,6-tetrahydro-2H-naphtho[2,1-f]chromen-11-yl]oxy]propane-1,3-diol (PubChem CID 162827752) has the molecular formula C43H48N2O8 and a molecular weight of 720.86 g/mol. Its IUPAC name is 2-[[3-[(cyclohexylamino)methoxy]-8-hydroxy-2-(4-hydroxy-3-methoxyphenyl)-6-(1H-indol-5-ylmethyl)-3,4,5,6-tetrahydro-2H-naphtho[2,1-f]chromen-11-yl]oxy]propane-1,3-diol.
| Compound Name | 2-[[3-[(cyclohexylamino)methoxy]-8-hydroxy-2-(4-hydroxy-3-methoxyphenyl)-6-(1H-indol-5-ylmethyl)-3,4,5,6-tetrahydro-2H-naphtho[2,1-f]chromen-11-yl]oxy]propane-1,3-diol |
|---|---|
| PubChem CID | 162827752 |
| Molecular Formula | C43H48N2O8 |
| Molecular Weight | 720.86 g/mol |
| Exact Mass | 720.34 |
| IUPAC Name | 2-[[3-[(cyclohexylamino)methoxy]-8-hydroxy-2-(4-hydroxy-3-methoxyphenyl)-6-(1H-indol-5-ylmethyl)-3,4,5,6-tetrahydro-2H-naphtho[2,1-f]chromen-11-yl]oxy]propane-1,3-diol |
| SMILES | COc1cc(C2Oc3cc(OC(CO)CO)c4c(c3CC2OCNC2CCCCC2)CC(Cc2ccc3[nH]ccc3c2)c2cc(O)ccc2-4)ccc1O |
| InChI | InChI=1S/C43H48N2O8/c1-50-39-18-27(8-12-37(39)49)43-41(51-24-45-29-5-3-2-4-6-29)20-34-35-17-28(16-25-7-11-36-26(15-25)13-14-44-36)33-19-30(48)9-10-32(33)42(35)40(21-38(34)53-43)52-31(22-46)23-47/h7-15,18-19,21,28-29,31,41,43-49H,2-6,16-17,20,22-24H2,1H3 |
| InChIKey | RXXINPRQHRBRFC-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 145.66 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.86 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|