C36H33NO6 — CID 163142418
(4R,5R,21R)-5-(4-hydroxy-3-methoxyphenyl)-21-(2H-indol-5-ylmethyl)-6,12-dioxapentacyclo[12.8.0.02,7.08,13.015,20]docosa-1,7,13,15(20),16,18-hexaene-4,18-diol (PubChem CID 163142418) has the molecular formula C36H33NO6 and a molecular weight of 575.66 g/mol. Its IUPAC name is (4R,5R,21R)-5-(4-hydroxy-3-methoxyphenyl)-21-(2H-indol-5-ylmethyl)-6,12-dioxapentacyclo[12.8.0.02,7.08,13.015,20]docosa-1,7,13,15(20),16,18-hexaene-4,18-diol.
| Compound Name | (4R,5R,21R)-5-(4-hydroxy-3-methoxyphenyl)-21-(2H-indol-5-ylmethyl)-6,12-dioxapentacyclo[12.8.0.02,7.08,13.015,20]docosa-1,7,13,15(20),16,18-hexaene-4,18-diol |
|---|---|
| PubChem CID | 163142418 |
| Molecular Formula | C36H33NO6 |
| Molecular Weight | 575.66 g/mol |
| Exact Mass | 575.23 |
| IUPAC Name | (4R,5R,21R)-5-(4-hydroxy-3-methoxyphenyl)-21-(2H-indol-5-ylmethyl)-6,12-dioxapentacyclo[12.8.0.02,7.08,13.015,20]docosa-1,7,13,15(20),16,18-hexaene-4,18-diol |
| SMILES | COc1cc([C@H]2Oc3c(c4c(c5c3CCCO5)-c3ccc(O)cc3[C@H](Cc3ccc5c(c3)=CCN=5)C4)C[C@H]2O)ccc1O |
| InChI | InChI=1S/C36H33NO6/c1-41-32-16-21(5-9-30(32)39)34-31(40)18-28-27-15-22(14-19-4-8-29-20(13-19)10-11-37-29)26-17-23(38)6-7-24(26)33(27)36-25(35(28)43-34)3-2-12-42-36/h4-10,13,16-17,22,31,34,38-40H,2-3,11-12,14-15,18H2,1H3/t22-,31-,34-/m1/s1 |
| InChIKey | KGSFUHMBCFMRQH-WBRMGUJQSA-N |
| XLogP | 4.43 |
| TPSA | 100.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.66 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |