C31H36O7 — CID 163095831
(2R,3R,5R)-11-(2-hydroxyethoxy)-2-(4-hydroxy-3-methoxyphenyl)-5-pentyl-3,4,5,6-tetrahydro-2H-naphtho[2,1-f]chromene-3,8-diol (PubChem CID 163095831) has the molecular formula C31H36O7 and a molecular weight of 520.62 g/mol. Its IUPAC name is (2R,3R,5R)-11-(2-hydroxyethoxy)-2-(4-hydroxy-3-methoxyphenyl)-5-pentyl-3,4,5,6-tetrahydro-2H-naphtho[2,1-f]chromene-3,8-diol.
| Compound Name | (2R,3R,5R)-11-(2-hydroxyethoxy)-2-(4-hydroxy-3-methoxyphenyl)-5-pentyl-3,4,5,6-tetrahydro-2H-naphtho[2,1-f]chromene-3,8-diol |
|---|---|
| PubChem CID | 163095831 |
| Molecular Formula | C31H36O7 |
| Molecular Weight | 520.62 g/mol |
| Exact Mass | 520.25 |
| IUPAC Name | (2R,3R,5R)-11-(2-hydroxyethoxy)-2-(4-hydroxy-3-methoxyphenyl)-5-pentyl-3,4,5,6-tetrahydro-2H-naphtho[2,1-f]chromene-3,8-diol |
| SMILES | CCCCC[C@@H]1Cc2cc(O)ccc2-c2c(OCCO)cc3c(c21)C[C@@H](O)[C@@H](c1ccc(O)c(OC)c1)O3 |
| InChI | InChI=1S/C31H36O7/c1-3-4-5-6-18-13-20-14-21(33)8-9-22(20)30-28(37-12-11-32)17-26-23(29(18)30)16-25(35)31(38-26)19-7-10-24(34)27(15-19)36-2/h7-10,14-15,17-18,25,31-35H,3-6,11-13,16H2,1-2H3/t18-,25-,31-/m1/s1 |
| InChIKey | FQTQPVFWGYZEIU-XOERONJASA-N |
| XLogP | 5.40 |
| TPSA | 108.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.62 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|