C37H48O7 — CID 162835931
(2S,3R,5S)-5-[(3S)-3-ethyl-6-hydroxyhexyl]-2-(4-hydroxy-3-methoxyphenyl)-11-methoxy-9-(2-methylpropyl)-3,4,5,6-tetrahydro-2H-naphtho[2,1-f]chromene-3,8-diol (PubChem CID 162835931) has the molecular formula C37H48O7 and a molecular weight of 604.78 g/mol. Its IUPAC name is (2S,3R,5S)-5-[(3S)-3-ethyl-6-hydroxyhexyl]-2-(4-hydroxy-3-methoxyphenyl)-11-methoxy-9-(2-methylpropyl)-3,4,5,6-tetrahydro-2H-naphtho[2,1-f]chromene-3,8-diol.
| Compound Name | (2S,3R,5S)-5-[(3S)-3-ethyl-6-hydroxyhexyl]-2-(4-hydroxy-3-methoxyphenyl)-11-methoxy-9-(2-methylpropyl)-3,4,5,6-tetrahydro-2H-naphtho[2,1-f]chromene-3,8-diol |
|---|---|
| PubChem CID | 162835931 |
| Molecular Formula | C37H48O7 |
| Molecular Weight | 604.78 g/mol |
| Exact Mass | 604.34 |
| IUPAC Name | (2S,3R,5S)-5-[(3S)-3-ethyl-6-hydroxyhexyl]-2-(4-hydroxy-3-methoxyphenyl)-11-methoxy-9-(2-methylpropyl)-3,4,5,6-tetrahydro-2H-naphtho[2,1-f]chromene-3,8-diol |
| SMILES | CCC(CCCO)CC[C@H]1Cc2cc(O)c(CC(C)C)cc2-c2c(OC)cc3c(c21)C[C@@H](O)[C@H](c1ccc(O)c(OC)c1)O3 |
| InChI | InChI=1S/C37H48O7/c1-6-22(8-7-13-38)9-10-23-15-25-17-30(40)26(14-21(2)3)16-27(25)36-34(43-5)20-32-28(35(23)36)19-31(41)37(44-32)24-11-12-29(39)33(18-24)42-4/h11-12,16-18,20-23,31,37-41H,6-10,13-15,19H2,1-5H3/t22?,23-,31+,37-/m0/s1 |
| InChIKey | RPTLFPPBWMCZJI-XUYHZPBKSA-N |
| XLogP | 7.24 |
| TPSA | 108.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.78 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |