C39H46O6 — CID 163088596
(13R,17R,18S)-18-(4-hydroxy-3-methoxyphenyl)-22-methoxy-13-[(4S)-4-methylnonyl]-19-oxapentacyclo[12.8.0.02,11.03,8.015,20]docosa-1(22),2(11),3,5,7,9,14,20-octaene-9,17-diol (PubChem CID 163088596) has the molecular formula C39H46O6 and a molecular weight of 610.79 g/mol. Its IUPAC name is (13R,17R,18S)-18-(4-hydroxy-3-methoxyphenyl)-22-methoxy-13-[(4S)-4-methylnonyl]-19-oxapentacyclo[12.8.0.02,11.03,8.015,20]docosa-1(22),2(11),3,5,7,9,14,20-octaene-9,17-diol.
| Compound Name | (13R,17R,18S)-18-(4-hydroxy-3-methoxyphenyl)-22-methoxy-13-[(4S)-4-methylnonyl]-19-oxapentacyclo[12.8.0.02,11.03,8.015,20]docosa-1(22),2(11),3,5,7,9,14,20-octaene-9,17-diol |
|---|---|
| PubChem CID | 163088596 |
| Molecular Formula | C39H46O6 |
| Molecular Weight | 610.79 g/mol |
| Exact Mass | 610.33 |
| IUPAC Name | (13R,17R,18S)-18-(4-hydroxy-3-methoxyphenyl)-22-methoxy-13-[(4S)-4-methylnonyl]-19-oxapentacyclo[12.8.0.02,11.03,8.015,20]docosa-1(22),2(11),3,5,7,9,14,20-octaene-9,17-diol |
| SMILES | CCCCC[C@H](C)CCC[C@@H]1Cc2cc(O)c3ccccc3c2-c2c(OC)cc3c(c21)C[C@@H](O)[C@H](c1ccc(O)c(OC)c1)O3 |
| InChI | InChI=1S/C39H46O6/c1-5-6-7-11-23(2)12-10-13-24-18-26-19-31(41)27-14-8-9-15-28(27)37(26)38-35(44-4)22-33-29(36(24)38)21-32(42)39(45-33)25-16-17-30(40)34(20-25)43-3/h8-9,14-17,19-20,22-24,32,39-42H,5-7,10-13,18,21H2,1-4H3/t23-,24+,32+,39-/m0/s1 |
| InChIKey | NGULTDWDJOGBEV-UJKIXIJQSA-N |
| XLogP | 9.00 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.79 |
| LogP ≤ 5 | 9.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|