C42H58O7 — CID 163100967
(2S,3R,5R)-2-(4-hydroxy-3-methoxyphenyl)-5-[(3S,4S)-3-(3-hydroxypropyl)-4-methylnonyl]-11-methoxy-9-(2-methylpropyl)-3,4,5,6-tetrahydro-2H-naphtho[2,1-f]chromene-3,8-diol (PubChem CID 163100967) has the molecular formula C42H58O7 and a molecular weight of 674.92 g/mol. Its IUPAC name is (2S,3R,5R)-2-(4-hydroxy-3-methoxyphenyl)-5-[(3S,4S)-3-(3-hydroxypropyl)-4-methylnonyl]-11-methoxy-9-(2-methylpropyl)-3,4,5,6-tetrahydro-2H-naphtho[2,1-f]chromene-3,8-diol.
| Compound Name | (2S,3R,5R)-2-(4-hydroxy-3-methoxyphenyl)-5-[(3S,4S)-3-(3-hydroxypropyl)-4-methylnonyl]-11-methoxy-9-(2-methylpropyl)-3,4,5,6-tetrahydro-2H-naphtho[2,1-f]chromene-3,8-diol |
|---|---|
| PubChem CID | 163100967 |
| Molecular Formula | C42H58O7 |
| Molecular Weight | 674.92 g/mol |
| Exact Mass | 674.42 |
| IUPAC Name | (2S,3R,5R)-2-(4-hydroxy-3-methoxyphenyl)-5-[(3S,4S)-3-(3-hydroxypropyl)-4-methylnonyl]-11-methoxy-9-(2-methylpropyl)-3,4,5,6-tetrahydro-2H-naphtho[2,1-f]chromene-3,8-diol |
| SMILES | CCCCC[C@H](C)[C@H](CCCO)CC[C@@H]1Cc2cc(O)c(CC(C)C)cc2-c2c(OC)cc3c(c21)C[C@@H](O)[C@H](c1ccc(O)c(OC)c1)O3 |
| InChI | InChI=1S/C42H58O7/c1-7-8-9-11-26(4)27(12-10-17-43)13-14-28-19-30-21-35(45)31(18-25(2)3)20-32(30)41-39(48-6)24-37-33(40(28)41)23-36(46)42(49-37)29-15-16-34(44)38(22-29)47-5/h15-16,20-22,24-28,36,42-46H,7-14,17-19,23H2,1-6H3/t26-,27+,28+,36+,42-/m0/s1 |
| InChIKey | GWRWOCWYEDAKRR-ADPIFPKWSA-N |
| XLogP | 9.04 |
| TPSA | 108.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.92 |
| LogP ≤ 5 | 9.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|