C44H58O7 — CID 162929089
5-[5-heptan-2-yl-4-(2-hydroxyethyl)cyclohex-2-en-1-yl]-2-(4-hydroxy-3-methoxyphenyl)-11-methoxy-9-(2-methylpropyl)-3,4,5,6-tetrahydro-2H-naphtho[2,1-f]chromene-3,8-diol (PubChem CID 162929089) has the molecular formula C44H58O7 and a molecular weight of 698.94 g/mol. Its IUPAC name is 5-[5-heptan-2-yl-4-(2-hydroxyethyl)cyclohex-2-en-1-yl]-2-(4-hydroxy-3-methoxyphenyl)-11-methoxy-9-(2-methylpropyl)-3,4,5,6-tetrahydro-2H-naphtho[2,1-f]chromene-3,8-diol.
| Compound Name | 5-[5-heptan-2-yl-4-(2-hydroxyethyl)cyclohex-2-en-1-yl]-2-(4-hydroxy-3-methoxyphenyl)-11-methoxy-9-(2-methylpropyl)-3,4,5,6-tetrahydro-2H-naphtho[2,1-f]chromene-3,8-diol |
|---|---|
| PubChem CID | 162929089 |
| Molecular Formula | C44H58O7 |
| Molecular Weight | 698.94 g/mol |
| Exact Mass | 698.42 |
| IUPAC Name | 5-[5-heptan-2-yl-4-(2-hydroxyethyl)cyclohex-2-en-1-yl]-2-(4-hydroxy-3-methoxyphenyl)-11-methoxy-9-(2-methylpropyl)-3,4,5,6-tetrahydro-2H-naphtho[2,1-f]chromene-3,8-diol |
| SMILES | CCCCCC(C)C1CC(C2Cc3cc(O)c(CC(C)C)cc3-c3c(OC)cc4c(c32)CC(O)C(c2ccc(O)c(OC)c2)O4)C=CC1CCO |
| InChI | InChI=1S/C44H58O7/c1-7-8-9-10-26(4)32-18-28(12-11-27(32)15-16-45)33-19-30-21-37(47)31(17-25(2)3)20-34(30)43-41(50-6)24-39-35(42(33)43)23-38(48)44(51-39)29-13-14-36(46)40(22-29)49-5/h11-14,20-22,24-28,32-33,38,44-48H,7-10,15-19,23H2,1-6H3 |
| InChIKey | KUJZMCADRGKPEY-UHFFFAOYSA-N |
| XLogP | 9.06 |
| TPSA | 108.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.94 |
| LogP ≤ 5 | 9.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|