C41H54O7 — CID 163101699
2-(3-cyclopentyloxy-4-hydroxyphenyl)-5-(3-ethyl-6-hydroxyhexyl)-11-methoxy-9-(2-methylpropyl)-3,4,5,6-tetrahydro-2H-naphtho[2,1-f]chromene-3,8-diol (PubChem CID 163101699) has the molecular formula C41H54O7 and a molecular weight of 658.88 g/mol. Its IUPAC name is 2-(3-cyclopentyloxy-4-hydroxyphenyl)-5-(3-ethyl-6-hydroxyhexyl)-11-methoxy-9-(2-methylpropyl)-3,4,5,6-tetrahydro-2H-naphtho[2,1-f]chromene-3,8-diol.
| Compound Name | 2-(3-cyclopentyloxy-4-hydroxyphenyl)-5-(3-ethyl-6-hydroxyhexyl)-11-methoxy-9-(2-methylpropyl)-3,4,5,6-tetrahydro-2H-naphtho[2,1-f]chromene-3,8-diol |
|---|---|
| PubChem CID | 163101699 |
| Molecular Formula | C41H54O7 |
| Molecular Weight | 658.88 g/mol |
| Exact Mass | 658.39 |
| IUPAC Name | 2-(3-cyclopentyloxy-4-hydroxyphenyl)-5-(3-ethyl-6-hydroxyhexyl)-11-methoxy-9-(2-methylpropyl)-3,4,5,6-tetrahydro-2H-naphtho[2,1-f]chromene-3,8-diol |
| SMILES | CCC(CCCO)CCC1Cc2cc(O)c(CC(C)C)cc2-c2c(OC)cc3c(c21)CC(O)C(c1ccc(O)c(OC2CCCC2)c1)O3 |
| InChI | InChI=1S/C41H54O7/c1-5-25(9-8-16-42)12-13-26-18-28-20-34(44)29(17-24(2)3)19-31(28)40-38(46-4)23-36-32(39(26)40)22-35(45)41(48-36)27-14-15-33(43)37(21-27)47-30-10-6-7-11-30/h14-15,19-21,23-26,30,35,41-45H,5-13,16-18,22H2,1-4H3 |
| InChIKey | FSVCQBIJVHOVIT-UHFFFAOYSA-N |
| XLogP | 8.55 |
| TPSA | 108.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.88 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |