C29H23FO11 — CID 166479812
[(2S,3R)-2-(2-fluoro-3,4,5-trihydroxyphenyl)-5-hydroxy-7-phenylmethoxy-3,4-dihydro-2H-chromen-3-yl] 3,4,5-trihydroxybenzoate (PubChem CID 166479812) has the molecular formula C29H23FO11 and a molecular weight of 566.49 g/mol. Its IUPAC name is [(2S,3R)-2-(2-fluoro-3,4,5-trihydroxyphenyl)-5-hydroxy-7-phenylmethoxy-3,4-dihydro-2H-chromen-3-yl] 3,4,5-trihydroxybenzoate.
| Compound Name | [(2S,3R)-2-(2-fluoro-3,4,5-trihydroxyphenyl)-5-hydroxy-7-phenylmethoxy-3,4-dihydro-2H-chromen-3-yl] 3,4,5-trihydroxybenzoate |
|---|---|
| PubChem CID | 166479812 |
| Molecular Formula | C29H23FO11 |
| Molecular Weight | 566.49 g/mol |
| Exact Mass | 566.12 |
| IUPAC Name | [(2S,3R)-2-(2-fluoro-3,4,5-trihydroxyphenyl)-5-hydroxy-7-phenylmethoxy-3,4-dihydro-2H-chromen-3-yl] 3,4,5-trihydroxybenzoate |
| SMILES | O=C(O[C@@H]1Cc2c(O)cc(OCc3ccccc3)cc2O[C@H]1c1cc(O)c(O)c(O)c1F)c1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C29H23FO11/c30-24-17(10-21(34)26(36)27(24)37)28-23(41-29(38)14-6-19(32)25(35)20(33)7-14)11-16-18(31)8-15(9-22(16)40-28)39-12-13-4-2-1-3-5-13/h1-10,23,28,31-37H,11-12H2/t23-,28+/m1/s1 |
| InChIKey | QCCSKUNMJODTJB-LXFBAYGMSA-N |
| XLogP | 4.25 |
| TPSA | 186.37 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.49 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|