C23H20O10 — CID 160928712
[(2R)-5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromen-3-yl] 3,4-dihydroxy-5-methylbenzoate (PubChem CID 160928712) has the molecular formula C23H20O10 and a molecular weight of 456.40 g/mol. Its IUPAC name is [(2R)-5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromen-3-yl] 3,4-dihydroxy-5-methylbenzoate.
| Compound Name | [(2R)-5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromen-3-yl] 3,4-dihydroxy-5-methylbenzoate |
|---|---|
| PubChem CID | 160928712 |
| Molecular Formula | C23H20O10 |
| Molecular Weight | 456.40 g/mol |
| Exact Mass | 456.11 |
| IUPAC Name | [(2R)-5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromen-3-yl] 3,4-dihydroxy-5-methylbenzoate |
| SMILES | Cc1cc(C(=O)OC2Cc3c(O)cc(O)cc3O[C@@H]2c2cc(O)c(O)c(O)c2)cc(O)c1O |
| InChI | InChI=1S/C23H20O10/c1-9-2-11(5-15(26)20(9)29)23(31)33-19-8-13-14(25)6-12(24)7-18(13)32-22(19)10-3-16(27)21(30)17(28)4-10/h2-7,19,22,24-30H,8H2,1H3/t19?,22-/m1/s1 |
| InChIKey | BCKPZQFULWYFPK-AVKWCDSFSA-N |
| XLogP | 2.84 |
| TPSA | 177.14 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.40 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|