C22H17FO10 — CID 175537309
[(2R)-5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromen-3-yl] 3-fluoro-4,5-dihydroxybenzoate (PubChem CID 175537309) has the molecular formula C22H17FO10 and a molecular weight of 460.37 g/mol. Its IUPAC name is [(2R)-5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromen-3-yl] 3-fluoro-4,5-dihydroxybenzoate.
| Compound Name | [(2R)-5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromen-3-yl] 3-fluoro-4,5-dihydroxybenzoate |
|---|---|
| PubChem CID | 175537309 |
| Molecular Formula | C22H17FO10 |
| Molecular Weight | 460.37 g/mol |
| Exact Mass | 460.08 |
| IUPAC Name | [(2R)-5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromen-3-yl] 3-fluoro-4,5-dihydroxybenzoate |
| SMILES | O=C(OC1Cc2c(O)cc(O)cc2O[C@@H]1c1cc(O)c(O)c(O)c1)c1cc(O)c(O)c(F)c1 |
| InChI | InChI=1S/C22H17FO10/c23-12-1-9(4-14(26)19(12)29)22(31)33-18-7-11-13(25)5-10(24)6-17(11)32-21(18)8-2-15(27)20(30)16(28)3-8/h1-6,18,21,24-30H,7H2/t18?,21-/m1/s1 |
| InChIKey | BPMIWQZEVFNGCT-BDPMCISCSA-N |
| XLogP | 2.67 |
| TPSA | 177.14 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.37 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|