C19H20O8 — CID 58982664
[(2R,3R)-5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromen-3-yl] 2-methylpropanoate (PubChem CID 58982664) has the molecular formula C19H20O8 and a molecular weight of 376.36 g/mol. Its IUPAC name is [(2R,3R)-5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromen-3-yl] 2-methylpropanoate.
| Compound Name | [(2R,3R)-5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromen-3-yl] 2-methylpropanoate |
|---|---|
| PubChem CID | 58982664 |
| Molecular Formula | C19H20O8 |
| Molecular Weight | 376.36 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | [(2R,3R)-5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromen-3-yl] 2-methylpropanoate |
| SMILES | CC(C)C(=O)O[C@@H]1Cc2c(O)cc(O)cc2O[C@@H]1c1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C19H20O8/c1-8(2)19(25)27-16-7-11-12(21)5-10(20)6-15(11)26-18(16)9-3-13(22)17(24)14(23)4-9/h3-6,8,16,18,20-24H,7H2,1-2H3/t16-,18-/m1/s1 |
| InChIKey | PTGLLSGITCGOME-SJLPKXTDSA-N |
| XLogP | 2.46 |
| TPSA | 136.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.36 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|