C27H28O10 — CID 101115400
[(2R,3R)-2-(4-butan-2-yl-3,5-dihydroxyphenyl)-5,7-dihydroxy-3,4-dihydro-2H-chromen-3-yl] 3,4-dihydroxy-5-methoxybenzoate (PubChem CID 101115400) has the molecular formula C27H28O10 and a molecular weight of 512.51 g/mol. Its IUPAC name is [(2R,3R)-2-(4-butan-2-yl-3,5-dihydroxyphenyl)-5,7-dihydroxy-3,4-dihydro-2H-chromen-3-yl] 3,4-dihydroxy-5-methoxybenzoate.
| Compound Name | [(2R,3R)-2-(4-butan-2-yl-3,5-dihydroxyphenyl)-5,7-dihydroxy-3,4-dihydro-2H-chromen-3-yl] 3,4-dihydroxy-5-methoxybenzoate |
|---|---|
| PubChem CID | 101115400 |
| Molecular Formula | C27H28O10 |
| Molecular Weight | 512.51 g/mol |
| Exact Mass | 512.17 |
| IUPAC Name | [(2R,3R)-2-(4-butan-2-yl-3,5-dihydroxyphenyl)-5,7-dihydroxy-3,4-dihydro-2H-chromen-3-yl] 3,4-dihydroxy-5-methoxybenzoate |
| SMILES | CCC(C)c1c(O)cc([C@H]2Oc3cc(O)cc(O)c3C[C@H]2OC(=O)c2cc(O)c(O)c(OC)c2)cc1O |
| InChI | InChI=1S/C27H28O10/c1-4-12(2)24-18(30)5-13(6-19(24)31)26-23(11-16-17(29)9-15(28)10-21(16)36-26)37-27(34)14-7-20(32)25(33)22(8-14)35-3/h5-10,12,23,26,28-33H,4,11H2,1-3H3/t12?,23-,26-/m1/s1 |
| InChIKey | WSKVBXQQUFCXIE-QYXDLXGESA-N |
| XLogP | 4.34 |
| TPSA | 166.14 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.51 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|