C23H20O11 — CID 11363448
[5,7-dihydroxy-3-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromen-2-yl] 3,4-dihydroxy-5-methoxybenzoate (PubChem CID 11363448) has the molecular formula C23H20O11 and a molecular weight of 472.40 g/mol. Its IUPAC name is [5,7-dihydroxy-3-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromen-2-yl] 3,4-dihydroxy-5-methoxybenzoate.
| Compound Name | [5,7-dihydroxy-3-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromen-2-yl] 3,4-dihydroxy-5-methoxybenzoate |
|---|---|
| PubChem CID | 11363448 |
| Molecular Formula | C23H20O11 |
| Molecular Weight | 472.40 g/mol |
| Exact Mass | 472.10 |
| IUPAC Name | [5,7-dihydroxy-3-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromen-2-yl] 3,4-dihydroxy-5-methoxybenzoate |
| SMILES | COc1cc(C(=O)OC2Oc3cc(O)cc(O)c3CC2c2cc(O)c(O)c(O)c2)cc(O)c1O |
| InChI | InChI=1S/C23H20O11/c1-32-19-5-10(4-17(28)21(19)30)22(31)34-23-12(9-2-15(26)20(29)16(27)3-9)8-13-14(25)6-11(24)7-18(13)33-23/h2-7,12,23-30H,8H2,1H3 |
| InChIKey | VMGSPYOVWLFNBQ-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 186.37 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.40 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|