C26H26O11 — CID 139249204
[(2R,3R)-5-hydroxy-7-methoxy-2-(3,4,5-trimethoxyphenyl)-3,4-dihydro-2H-chromen-3-yl] 3,4,5-trihydroxybenzoate (PubChem CID 139249204) has the molecular formula C26H26O11 and a molecular weight of 514.48 g/mol. Its IUPAC name is [(2R,3R)-5-hydroxy-7-methoxy-2-(3,4,5-trimethoxyphenyl)-3,4-dihydro-2H-chromen-3-yl] 3,4,5-trihydroxybenzoate.
| Compound Name | [(2R,3R)-5-hydroxy-7-methoxy-2-(3,4,5-trimethoxyphenyl)-3,4-dihydro-2H-chromen-3-yl] 3,4,5-trihydroxybenzoate |
|---|---|
| PubChem CID | 139249204 |
| Molecular Formula | C26H26O11 |
| Molecular Weight | 514.48 g/mol |
| Exact Mass | 514.15 |
| IUPAC Name | [(2R,3R)-5-hydroxy-7-methoxy-2-(3,4,5-trimethoxyphenyl)-3,4-dihydro-2H-chromen-3-yl] 3,4,5-trihydroxybenzoate |
| SMILES | COc1cc(O)c2c(c1)O[C@H](c1cc(OC)c(OC)c(OC)c1)[C@H](OC(=O)c1cc(O)c(O)c(O)c1)C2 |
| InChI | InChI=1S/C26H26O11/c1-32-14-9-16(27)15-11-22(37-26(31)13-5-17(28)23(30)18(29)6-13)24(36-19(15)10-14)12-7-20(33-2)25(35-4)21(8-12)34-3/h5-10,22,24,27-30H,11H2,1-4H3/t22-,24-/m1/s1 |
| InChIKey | AQCYDEFTJMPPGF-ISKFKSNPSA-N |
| XLogP | 3.45 |
| TPSA | 153.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.48 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|