C24H20O11 — CID 58717501
[(2R,3R)-7-formyl-5-methoxy-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromen-3-yl] 3,4,5-trihydroxybenzoate (PubChem CID 58717501) has the molecular formula C24H20O11 and a molecular weight of 484.41 g/mol. Its IUPAC name is [(2R,3R)-7-formyl-5-methoxy-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromen-3-yl] 3,4,5-trihydroxybenzoate.
| Compound Name | [(2R,3R)-7-formyl-5-methoxy-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromen-3-yl] 3,4,5-trihydroxybenzoate |
|---|---|
| PubChem CID | 58717501 |
| Molecular Formula | C24H20O11 |
| Molecular Weight | 484.41 g/mol |
| Exact Mass | 484.10 |
| IUPAC Name | [(2R,3R)-7-formyl-5-methoxy-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromen-3-yl] 3,4,5-trihydroxybenzoate |
| SMILES | COc1cc(C=O)cc2c1C[C@@H](OC(=O)c1cc(O)c(O)c(O)c1)[C@@H](c1cc(O)c(O)c(O)c1)O2 |
| InChI | InChI=1S/C24H20O11/c1-33-18-2-10(9-25)3-19-13(18)8-20(23(34-19)11-4-14(26)21(30)15(27)5-11)35-24(32)12-6-16(28)22(31)17(29)7-12/h2-7,9,20,23,26-31H,8H2,1H3/t20-,23-/m1/s1 |
| InChIKey | FYUWXWKCOWJXLR-NFBKMPQASA-N |
| XLogP | 2.64 |
| TPSA | 183.21 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.41 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|