C25H24O11 — CID 53357909
[5,7-dimethoxy-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromen-3-yl] 3,5-dihydroxy-4-methoxybenzoate (PubChem CID 53357909) has the molecular formula C25H24O11 and a molecular weight of 500.46 g/mol. Its IUPAC name is [5,7-dimethoxy-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromen-3-yl] 3,5-dihydroxy-4-methoxybenzoate.
| Compound Name | [5,7-dimethoxy-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromen-3-yl] 3,5-dihydroxy-4-methoxybenzoate |
|---|---|
| PubChem CID | 53357909 |
| Molecular Formula | C25H24O11 |
| Molecular Weight | 500.46 g/mol |
| Exact Mass | 500.13 |
| IUPAC Name | [5,7-dimethoxy-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromen-3-yl] 3,5-dihydroxy-4-methoxybenzoate |
| SMILES | COc1cc(OC)c2c(c1)OC(c1cc(O)c(O)c(O)c1)C(OC(=O)c1cc(O)c(OC)c(O)c1)C2 |
| InChI | InChI=1S/C25H24O11/c1-32-13-8-19(33-2)14-10-21(36-25(31)12-6-17(28)24(34-3)18(29)7-12)23(35-20(14)9-13)11-4-15(26)22(30)16(27)5-11/h4-9,21,23,26-30H,10H2,1-3H3 |
| InChIKey | UBCOQIHTBYTRFD-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 164.37 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.46 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|