C36H46O11 — CID 77107852
[(2R,3R)-5-ethoxy-7-hydroxy-2-(3,4,5-triethoxyphenyl)-3,4-dihydro-2H-chromen-3-yl] 3,4,5-triethoxybenzoate (PubChem CID 77107852) has the molecular formula C36H46O11 and a molecular weight of 654.75 g/mol. Its IUPAC name is [(2R,3R)-5-ethoxy-7-hydroxy-2-(3,4,5-triethoxyphenyl)-3,4-dihydro-2H-chromen-3-yl] 3,4,5-triethoxybenzoate.
| Compound Name | [(2R,3R)-5-ethoxy-7-hydroxy-2-(3,4,5-triethoxyphenyl)-3,4-dihydro-2H-chromen-3-yl] 3,4,5-triethoxybenzoate |
|---|---|
| PubChem CID | 77107852 |
| Molecular Formula | C36H46O11 |
| Molecular Weight | 654.75 g/mol |
| Exact Mass | 654.30 |
| IUPAC Name | [(2R,3R)-5-ethoxy-7-hydroxy-2-(3,4,5-triethoxyphenyl)-3,4-dihydro-2H-chromen-3-yl] 3,4,5-triethoxybenzoate |
| SMILES | CCOc1cc(O)cc2c1C[C@@H](OC(=O)c1cc(OCC)c(OCC)c(OCC)c1)[C@@H](c1cc(OCC)c(OCC)c(OCC)c1)O2 |
| InChI | InChI=1S/C36H46O11/c1-8-39-26-19-24(37)20-27-25(26)21-32(33(46-27)22-15-28(40-9-2)34(44-13-6)29(16-22)41-10-3)47-36(38)23-17-30(42-11-4)35(45-14-7)31(18-23)43-12-5/h15-20,32-33,37H,8-14,21H2,1-7H3/t32-,33-/m1/s1 |
| InChIKey | JUGFGDVTEYCVEJ-CZNDPXEESA-N |
| XLogP | 7.08 |
| TPSA | 120.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.75 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |