C46H77NO5Si4 — CID 11585955
(2R,3R)-N-benzyl-2-[3,4-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]-5,7-bis[[tert-butyl(dimethyl)silyl]oxy]-3,4-dihydro-2H-chromen-3-amine (PubChem CID 11585955) has the molecular formula C46H77NO5Si4 and a molecular weight of 836.47 g/mol. Its IUPAC name is (2R,3R)-N-benzyl-2-[3,4-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]-5,7-bis[[tert-butyl(dimethyl)silyl]oxy]-3,4-dihydro-2H-chromen-3-amine.
| Compound Name | (2R,3R)-N-benzyl-2-[3,4-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]-5,7-bis[[tert-butyl(dimethyl)silyl]oxy]-3,4-dihydro-2H-chromen-3-amine |
|---|---|
| PubChem CID | 11585955 |
| Molecular Formula | C46H77NO5Si4 |
| Molecular Weight | 836.47 g/mol |
| Exact Mass | 835.49 |
| IUPAC Name | (2R,3R)-N-benzyl-2-[3,4-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]-5,7-bis[[tert-butyl(dimethyl)silyl]oxy]-3,4-dihydro-2H-chromen-3-amine |
| SMILES | CC(C)(C)[Si](C)(C)Oc1cc2c(c(O[Si](C)(C)C(C)(C)C)c1)C[C@@H](NCc1ccccc1)[C@@H](c1ccc(O[Si](C)(C)C(C)(C)C)c(O[Si](C)(C)C(C)(C)C)c1)O2 |
| InChI | InChI=1S/C46H77NO5Si4/c1-43(2,3)53(13,14)49-35-29-39-36(40(30-35)51-55(17,18)45(7,8)9)31-37(47-32-33-24-22-21-23-25-33)42(48-39)34-26-27-38(50-54(15,16)44(4,5)6)41(28-34)52-56(19,20)46(10,11)12/h21-30,37,42,47H,31-32H2,1-20H3/t37-,42-/m1/s1 |
| InChIKey | KWANVIVLJCBYLT-GLAVYMFISA-N |
| XLogP | 14.06 |
| TPSA | 58.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 836.47 |
| LogP ≤ 5 | 14.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|