C47H38O14 — CID 118886888
benzyl [(3R)-2-[3,4-bis(phenylmethoxycarbonyloxy)phenyl]-3-hydroxy-5-phenylmethoxycarbonyloxy-3,4-dihydro-2H-chromen-7-yl] carbonate (PubChem CID 118886888) has the molecular formula C47H38O14 and a molecular weight of 826.81 g/mol. Its IUPAC name is benzyl [(3R)-2-[3,4-bis(phenylmethoxycarbonyloxy)phenyl]-3-hydroxy-5-phenylmethoxycarbonyloxy-3,4-dihydro-2H-chromen-7-yl] carbonate.
| Compound Name | benzyl [(3R)-2-[3,4-bis(phenylmethoxycarbonyloxy)phenyl]-3-hydroxy-5-phenylmethoxycarbonyloxy-3,4-dihydro-2H-chromen-7-yl] carbonate |
|---|---|
| PubChem CID | 118886888 |
| Molecular Formula | C47H38O14 |
| Molecular Weight | 826.81 g/mol |
| Exact Mass | 826.23 |
| IUPAC Name | benzyl [(3R)-2-[3,4-bis(phenylmethoxycarbonyloxy)phenyl]-3-hydroxy-5-phenylmethoxycarbonyloxy-3,4-dihydro-2H-chromen-7-yl] carbonate |
| SMILES | O=C(OCc1ccccc1)Oc1cc(OC(=O)OCc2ccccc2)c2c(c1)OC(c1ccc(OC(=O)OCc3ccccc3)c(OC(=O)OCc3ccccc3)c1)[C@H](O)C2 |
| InChI | InChI=1S/C47H38O14/c48-38-26-37-40(24-36(57-44(49)53-27-31-13-5-1-6-14-31)25-41(37)60-46(51)55-29-33-17-9-3-10-18-33)58-43(38)35-21-22-39(59-45(50)54-28-32-15-7-2-8-16-32)42(23-35)61-47(52)56-30-34-19-11-4-12-20-34/h1-25,38,43,48H,26-30H2/t38-,43?/m1/s1 |
| InChIKey | OGABRJBKEOAHHZ-QDXHBRHUSA-N |
| XLogP | 9.59 |
| TPSA | 171.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 61 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 826.81 |
| LogP ≤ 5 | 9.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|