C17H14O10 — CID 118875747
[(2R,3R)-5-carboxyoxy-2-(3,4-dihydroxyphenyl)-3-hydroxy-3,4-dihydro-2H-chromen-7-yl] hydrogen carbonate (PubChem CID 118875747) has the molecular formula C17H14O10 and a molecular weight of 378.29 g/mol. Its IUPAC name is [(2R,3R)-5-carboxyoxy-2-(3,4-dihydroxyphenyl)-3-hydroxy-3,4-dihydro-2H-chromen-7-yl] hydrogen carbonate.
| Compound Name | [(2R,3R)-5-carboxyoxy-2-(3,4-dihydroxyphenyl)-3-hydroxy-3,4-dihydro-2H-chromen-7-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 118875747 |
| Molecular Formula | C17H14O10 |
| Molecular Weight | 378.29 g/mol |
| Exact Mass | 378.06 |
| IUPAC Name | [(2R,3R)-5-carboxyoxy-2-(3,4-dihydroxyphenyl)-3-hydroxy-3,4-dihydro-2H-chromen-7-yl] hydrogen carbonate |
| SMILES | O=C(O)Oc1cc(OC(=O)O)c2c(c1)O[C@H](c1ccc(O)c(O)c1)[C@H](O)C2 |
| InChI | InChI=1S/C17H14O10/c18-10-2-1-7(3-11(10)19)15-12(20)6-9-13(26-15)4-8(25-16(21)22)5-14(9)27-17(23)24/h1-5,12,15,18-20H,6H2,(H,21,22)(H,23,24)/t12-,15-/m1/s1 |
| InChIKey | VOZYCEHKFWDEMJ-IUODEOHRSA-N |
| XLogP | 2.25 |
| TPSA | 162.98 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.29 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|