C23H28O7 — CID 86271808
[(2R,3R)-2-(3,4-dihydroxyphenyl)-3,7-dihydroxy-3,4-dihydro-2H-chromen-5-yl] octanoate (PubChem CID 86271808) has the molecular formula C23H28O7 and a molecular weight of 416.47 g/mol. Its IUPAC name is [(2R,3R)-2-(3,4-dihydroxyphenyl)-3,7-dihydroxy-3,4-dihydro-2H-chromen-5-yl] octanoate.
| Compound Name | [(2R,3R)-2-(3,4-dihydroxyphenyl)-3,7-dihydroxy-3,4-dihydro-2H-chromen-5-yl] octanoate |
|---|---|
| PubChem CID | 86271808 |
| Molecular Formula | C23H28O7 |
| Molecular Weight | 416.47 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | [(2R,3R)-2-(3,4-dihydroxyphenyl)-3,7-dihydroxy-3,4-dihydro-2H-chromen-5-yl] octanoate |
| SMILES | CCCCCCCC(=O)Oc1cc(O)cc2c1C[C@@H](O)[C@@H](c1ccc(O)c(O)c1)O2 |
| InChI | InChI=1S/C23H28O7/c1-2-3-4-5-6-7-22(28)29-20-11-15(24)12-21-16(20)13-19(27)23(30-21)14-8-9-17(25)18(26)10-14/h8-12,19,23-27H,2-7,13H2,1H3/t19-,23-/m1/s1 |
| InChIKey | JUGOZNHZEAZRLG-AUSIDOKSSA-N |
| XLogP | 4.11 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.47 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|