C31H42O8 — CID 69306453
[(2R,3S)-2-(3,4-dihydroxyphenyl)-3-hydroxy-5-octanoyloxy-3,4-dihydro-2H-chromen-7-yl] octanoate (PubChem CID 69306453) has the molecular formula C31H42O8 and a molecular weight of 542.67 g/mol. Its IUPAC name is [(2R,3S)-2-(3,4-dihydroxyphenyl)-3-hydroxy-5-octanoyloxy-3,4-dihydro-2H-chromen-7-yl] octanoate.
| Compound Name | [(2R,3S)-2-(3,4-dihydroxyphenyl)-3-hydroxy-5-octanoyloxy-3,4-dihydro-2H-chromen-7-yl] octanoate |
|---|---|
| PubChem CID | 69306453 |
| Molecular Formula | C31H42O8 |
| Molecular Weight | 542.67 g/mol |
| Exact Mass | 542.29 |
| IUPAC Name | [(2R,3S)-2-(3,4-dihydroxyphenyl)-3-hydroxy-5-octanoyloxy-3,4-dihydro-2H-chromen-7-yl] octanoate |
| SMILES | CCCCCCCC(=O)Oc1cc(OC(=O)CCCCCCC)c2c(c1)O[C@H](c1ccc(O)c(O)c1)[C@@H](O)C2 |
| InChI | InChI=1S/C31H42O8/c1-3-5-7-9-11-13-29(35)37-22-18-27(38-30(36)14-12-10-8-6-4-2)23-20-26(34)31(39-28(23)19-22)21-15-16-24(32)25(33)17-21/h15-19,26,31-34H,3-14,20H2,1-2H3/t26-,31+/m0/s1 |
| InChIKey | JINIFXNPIRIBKZ-SUYBVONHSA-N |
| XLogP | 6.67 |
| TPSA | 122.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.67 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|