C47H70O10 — CID 69308955
[(2R,3S)-2-(3,4-dihydroxyphenyl)-4-octanoyl-5,7-di(octanoyloxy)-3,4-dihydro-2H-chromen-3-yl] octanoate (PubChem CID 69308955) has the molecular formula C47H70O10 and a molecular weight of 795.07 g/mol. Its IUPAC name is [(2R,3S)-2-(3,4-dihydroxyphenyl)-4-octanoyl-5,7-di(octanoyloxy)-3,4-dihydro-2H-chromen-3-yl] octanoate.
| Compound Name | [(2R,3S)-2-(3,4-dihydroxyphenyl)-4-octanoyl-5,7-di(octanoyloxy)-3,4-dihydro-2H-chromen-3-yl] octanoate |
|---|---|
| PubChem CID | 69308955 |
| Molecular Formula | C47H70O10 |
| Molecular Weight | 795.07 g/mol |
| Exact Mass | 794.50 |
| IUPAC Name | [(2R,3S)-2-(3,4-dihydroxyphenyl)-4-octanoyl-5,7-di(octanoyloxy)-3,4-dihydro-2H-chromen-3-yl] octanoate |
| SMILES | CCCCCCCC(=O)Oc1cc(OC(=O)CCCCCCC)c2c(c1)O[C@H](c1ccc(O)c(O)c1)[C@@H](OC(=O)CCCCCCC)C2C(=O)CCCCCCC |
| InChI | InChI=1S/C47H70O10/c1-5-9-13-17-21-25-37(49)44-45-39(55-42(52)27-23-19-15-11-7-3)32-35(54-41(51)26-22-18-14-10-6-2)33-40(45)56-46(34-29-30-36(48)38(50)31-34)47(44)57-43(53)28-24-20-16-12-8-4/h29-33,44,46-48,50H,5-28H2,1-4H3/t44?,46-,47+/m1/s1 |
| InChIKey | OSDYLKPAVCHOGU-OIGQWEMTSA-N |
| XLogP | 12.05 |
| TPSA | 145.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 795.07 |
| LogP ≤ 5 | 12.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|