C23H28O7 — CID 151399493
(2R)-2-[(3R)-2-(3,4-dihydroxyphenyl)-3,5-dihydroxy-3,4-dihydro-2H-chromen-7-yl]octanoic acid (PubChem CID 151399493) has the molecular formula C23H28O7 and a molecular weight of 416.47 g/mol. Its IUPAC name is (2R)-2-[(3R)-2-(3,4-dihydroxyphenyl)-3,5-dihydroxy-3,4-dihydro-2H-chromen-7-yl]octanoic acid.
| Compound Name | (2R)-2-[(3R)-2-(3,4-dihydroxyphenyl)-3,5-dihydroxy-3,4-dihydro-2H-chromen-7-yl]octanoic acid |
|---|---|
| PubChem CID | 151399493 |
| Molecular Formula | C23H28O7 |
| Molecular Weight | 416.47 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | (2R)-2-[(3R)-2-(3,4-dihydroxyphenyl)-3,5-dihydroxy-3,4-dihydro-2H-chromen-7-yl]octanoic acid |
| SMILES | CCCCCC[C@@H](C(=O)O)c1cc(O)c2c(c1)OC(c1ccc(O)c(O)c1)[C@H](O)C2 |
| InChI | InChI=1S/C23H28O7/c1-2-3-4-5-6-15(23(28)29)14-10-18(25)16-12-20(27)22(30-21(16)11-14)13-7-8-17(24)19(26)9-13/h7-11,15,20,22,24-27H,2-6,12H2,1H3,(H,28,29)/t15-,20-,22?/m1/s1 |
| InChIKey | OWECBLOGEXNTDT-LDHILPOSSA-N |
| XLogP | 3.98 |
| TPSA | 127.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.47 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|