C27H38O6 — CID 71260096
(2R,3R)-5,7-dibutoxy-2-(4-butoxy-3-hydroxyphenyl)-3,4-dihydro-2H-chromen-3-ol (PubChem CID 71260096) has the molecular formula C27H38O6 and a molecular weight of 458.60 g/mol. Its IUPAC name is (2R,3R)-5,7-dibutoxy-2-(4-butoxy-3-hydroxyphenyl)-3,4-dihydro-2H-chromen-3-ol.
| Compound Name | (2R,3R)-5,7-dibutoxy-2-(4-butoxy-3-hydroxyphenyl)-3,4-dihydro-2H-chromen-3-ol |
|---|---|
| PubChem CID | 71260096 |
| Molecular Formula | C27H38O6 |
| Molecular Weight | 458.60 g/mol |
| Exact Mass | 458.27 |
| IUPAC Name | (2R,3R)-5,7-dibutoxy-2-(4-butoxy-3-hydroxyphenyl)-3,4-dihydro-2H-chromen-3-ol |
| SMILES | CCCCOc1cc(OCCCC)c2c(c1)O[C@H](c1ccc(OCCCC)c(O)c1)[C@H](O)C2 |
| InChI | InChI=1S/C27H38O6/c1-4-7-12-30-20-16-25(32-14-9-6-3)21-18-23(29)27(33-26(21)17-20)19-10-11-24(22(28)15-19)31-13-8-5-2/h10-11,15-17,23,27-29H,4-9,12-14,18H2,1-3H3/t23-,27-/m1/s1 |
| InChIKey | XYHHVBYBUMLEOM-YIXXDRMTSA-N |
| XLogP | 5.97 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.60 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|