C31H46O5 — CID 70319763
(2R)-5,7-dibutoxy-2-(3,4-dibutoxyphenyl)-3,4-dihydro-2H-chromene (PubChem CID 70319763) has the molecular formula C31H46O5 and a molecular weight of 498.70 g/mol. Its IUPAC name is (2R)-5,7-dibutoxy-2-(3,4-dibutoxyphenyl)-3,4-dihydro-2H-chromene.
| Compound Name | (2R)-5,7-dibutoxy-2-(3,4-dibutoxyphenyl)-3,4-dihydro-2H-chromene |
|---|---|
| PubChem CID | 70319763 |
| Molecular Formula | C31H46O5 |
| Molecular Weight | 498.70 g/mol |
| Exact Mass | 498.33 |
| IUPAC Name | (2R)-5,7-dibutoxy-2-(3,4-dibutoxyphenyl)-3,4-dihydro-2H-chromene |
| SMILES | CCCCOc1cc(OCCCC)c2c(c1)O[C@@H](c1ccc(OCCCC)c(OCCCC)c1)CC2 |
| InChI | InChI=1S/C31H46O5/c1-5-9-17-32-25-22-29(34-19-11-7-3)26-14-16-27(36-30(26)23-25)24-13-15-28(33-18-10-6-2)31(21-24)35-20-12-8-4/h13,15,21-23,27H,5-12,14,16-20H2,1-4H3/t27-/m1/s1 |
| InChIKey | WKWMLYZAEHGYOA-HHHXNRCGSA-N |
| XLogP | 8.47 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.70 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|