C23H28O6 — CID 91715643
2-(3,4-dibutoxyphenyl)-5,7-dihydroxy-2,3-dihydrochromen-4-one (PubChem CID 91715643) has the molecular formula C23H28O6 and a molecular weight of 400.47 g/mol. Its IUPAC name is 2-(3,4-dibutoxyphenyl)-5,7-dihydroxy-2,3-dihydrochromen-4-one.
| Compound Name | 2-(3,4-dibutoxyphenyl)-5,7-dihydroxy-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 91715643 |
| Molecular Formula | C23H28O6 |
| Molecular Weight | 400.47 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | 2-(3,4-dibutoxyphenyl)-5,7-dihydroxy-2,3-dihydrochromen-4-one |
| SMILES | CCCCOc1ccc(C2CC(=O)c3c(O)cc(O)cc3O2)cc1OCCCC |
| InChI | InChI=1S/C23H28O6/c1-3-5-9-27-19-8-7-15(11-21(19)28-10-6-4-2)20-14-18(26)23-17(25)12-16(24)13-22(23)29-20/h7-8,11-13,20,24-25H,3-6,9-10,14H2,1-2H3 |
| InChIKey | MGERMVNXQFGWSJ-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.47 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|