C21H32F3NO7SSi — CID 91389517
5-[[1-[tert-butyl(dimethyl)silyl]oxy-3,3-dimethylbutan-2-yl]carbamoyl]-2-(trifluoromethylsulfonyloxy)benzoic acid (PubChem CID 91389517) has the molecular formula C21H32F3NO7SSi and a molecular weight of 527.63 g/mol. Its IUPAC name is 5-[[1-[tert-butyl(dimethyl)silyl]oxy-3,3-dimethylbutan-2-yl]carbamoyl]-2-(trifluoromethylsulfonyloxy)benzoic acid.
| Compound Name | 5-[[1-[tert-butyl(dimethyl)silyl]oxy-3,3-dimethylbutan-2-yl]carbamoyl]-2-(trifluoromethylsulfonyloxy)benzoic acid |
|---|---|
| PubChem CID | 91389517 |
| Molecular Formula | C21H32F3NO7SSi |
| Molecular Weight | 527.63 g/mol |
| Exact Mass | 527.16 |
| IUPAC Name | 5-[[1-[tert-butyl(dimethyl)silyl]oxy-3,3-dimethylbutan-2-yl]carbamoyl]-2-(trifluoromethylsulfonyloxy)benzoic acid |
| SMILES | CC(C)(C)C(CO[Si](C)(C)C(C)(C)C)NC(=O)c1ccc(OS(=O)(=O)C(F)(F)F)c(C(=O)O)c1 |
| InChI | InChI=1S/C21H32F3NO7SSi/c1-19(2,3)16(12-31-34(7,8)20(4,5)6)25-17(26)13-9-10-15(14(11-13)18(27)28)32-33(29,30)21(22,23)24/h9-11,16H,12H2,1-8H3,(H,25,26)(H,27,28) |
| InChIKey | DACHHQXFNNVFCA-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.63 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|