C19H28F3NO5SSi — CID 10885148
[2-[[(E)-4-[tert-butyl(dimethyl)silyl]oxy-2-methylbut-2-enoyl]-methylamino]phenyl] trifluoromethanesulfonate (PubChem CID 10885148) has the molecular formula C19H28F3NO5SSi and a molecular weight of 467.58 g/mol. Its IUPAC name is [2-[[(E)-4-[tert-butyl(dimethyl)silyl]oxy-2-methylbut-2-enoyl]-methylamino]phenyl] trifluoromethanesulfonate.
| Compound Name | [2-[[(E)-4-[tert-butyl(dimethyl)silyl]oxy-2-methylbut-2-enoyl]-methylamino]phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 10885148 |
| Molecular Formula | C19H28F3NO5SSi |
| Molecular Weight | 467.58 g/mol |
| Exact Mass | 467.14 |
| IUPAC Name | [2-[[(E)-4-[tert-butyl(dimethyl)silyl]oxy-2-methylbut-2-enoyl]-methylamino]phenyl] trifluoromethanesulfonate |
| SMILES | C/C(=C\CO[Si](C)(C)C(C)(C)C)C(=O)N(C)c1ccccc1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C19H28F3NO5SSi/c1-14(12-13-27-30(6,7)18(2,3)4)17(24)23(5)15-10-8-9-11-16(15)28-29(25,26)19(20,21)22/h8-12H,13H2,1-7H3/b14-12+ |
| InChIKey | UHCBVFGSYSLDCE-WYMLVPIESA-N |
| XLogP | 4.85 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.58 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|