C12H12F3NO4S — CID 134851775
[2-[methyl(2-methylprop-2-enoyl)amino]phenyl] trifluoromethanesulfonate (PubChem CID 134851775) has the molecular formula C12H12F3NO4S and a molecular weight of 323.29 g/mol. Its IUPAC name is [2-[methyl(2-methylprop-2-enoyl)amino]phenyl] trifluoromethanesulfonate.
| Compound Name | [2-[methyl(2-methylprop-2-enoyl)amino]phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 134851775 |
| Molecular Formula | C12H12F3NO4S |
| Molecular Weight | 323.29 g/mol |
| Exact Mass | 323.04 |
| IUPAC Name | [2-[methyl(2-methylprop-2-enoyl)amino]phenyl] trifluoromethanesulfonate |
| SMILES | C=C(C)C(=O)N(C)c1ccccc1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C12H12F3NO4S/c1-8(2)11(17)16(3)9-6-4-5-7-10(9)20-21(18,19)12(13,14)15/h4-7H,1H2,2-3H3 |
| InChIKey | JZBDLZZWFUHTSS-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.29 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|