C36H30F6N2O8S2 — CID 11614779
[2-[benzyl-[2-[benzyl-[2-(trifluoromethylsulfonyloxy)phenyl]carbamoyl]cyclohexene-1-carbonyl]amino]phenyl] trifluoromethanesulfonate (PubChem CID 11614779) has the molecular formula C36H30F6N2O8S2 and a molecular weight of 796.76 g/mol. Its IUPAC name is [2-[benzyl-[2-[benzyl-[2-(trifluoromethylsulfonyloxy)phenyl]carbamoyl]cyclohexene-1-carbonyl]amino]phenyl] trifluoromethanesulfonate.
| Compound Name | [2-[benzyl-[2-[benzyl-[2-(trifluoromethylsulfonyloxy)phenyl]carbamoyl]cyclohexene-1-carbonyl]amino]phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 11614779 |
| Molecular Formula | C36H30F6N2O8S2 |
| Molecular Weight | 796.76 g/mol |
| Exact Mass | 796.13 |
| IUPAC Name | [2-[benzyl-[2-[benzyl-[2-(trifluoromethylsulfonyloxy)phenyl]carbamoyl]cyclohexene-1-carbonyl]amino]phenyl] trifluoromethanesulfonate |
| SMILES | O=C(C1=C(C(=O)N(Cc2ccccc2)c2ccccc2OS(=O)(=O)C(F)(F)F)CCCC1)N(Cc1ccccc1)c1ccccc1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C36H30F6N2O8S2/c37-35(38,39)53(47,48)51-31-21-11-9-19-29(31)43(23-25-13-3-1-4-14-25)33(45)27-17-7-8-18-28(27)34(46)44(24-26-15-5-2-6-16-26)30-20-10-12-22-32(30)52-54(49,50)36(40,41)42/h1-6,9-16,19-22H,7-8,17-18,23-24H2 |
| InChIKey | PFUQWDFCXAUKAN-UHFFFAOYSA-N |
| XLogP | 7.78 |
| TPSA | 127.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 796.76 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|