C25H26F3NO4S — CID 11576836
[2-[[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydronaphthalene-2-carbonyl]-benzylamino]phenyl] trifluoromethanesulfonate (PubChem CID 11576836) has the molecular formula C25H26F3NO4S and a molecular weight of 493.55 g/mol. Its IUPAC name is [2-[[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydronaphthalene-2-carbonyl]-benzylamino]phenyl] trifluoromethanesulfonate.
| Compound Name | [2-[[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydronaphthalene-2-carbonyl]-benzylamino]phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 11576836 |
| Molecular Formula | C25H26F3NO4S |
| Molecular Weight | 493.55 g/mol |
| Exact Mass | 493.15 |
| IUPAC Name | [2-[[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydronaphthalene-2-carbonyl]-benzylamino]phenyl] trifluoromethanesulfonate |
| SMILES | O=C(C1=C[C@H]2CCCC[C@@H]2CC1)N(Cc1ccccc1)c1ccccc1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C25H26F3NO4S/c26-25(27,28)34(31,32)33-23-13-7-6-12-22(23)29(17-18-8-2-1-3-9-18)24(30)21-15-14-19-10-4-5-11-20(19)16-21/h1-3,6-9,12-13,16,19-20H,4-5,10-11,14-15,17H2/t19-,20-/m1/s1 |
| InChIKey | ZRJCOFQAGJRAHY-WOJBJXKFSA-N |
| XLogP | 5.97 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.55 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|