C38H35F3N2O7S — CID 11657744
[2-[[(3aR,7aR)-6-[benzyl(phenyl)carbamoyl]-2,2-dimethyl-3a,4,7,7a-tetrahydro-1,3-benzodioxole-5-carbonyl]-benzylamino]phenyl] trifluoromethanesulfonate (PubChem CID 11657744) has the molecular formula C38H35F3N2O7S and a molecular weight of 720.77 g/mol. Its IUPAC name is [2-[[(3aR,7aR)-6-[benzyl(phenyl)carbamoyl]-2,2-dimethyl-3a,4,7,7a-tetrahydro-1,3-benzodioxole-5-carbonyl]-benzylamino]phenyl] trifluoromethanesulfonate.
| Compound Name | [2-[[(3aR,7aR)-6-[benzyl(phenyl)carbamoyl]-2,2-dimethyl-3a,4,7,7a-tetrahydro-1,3-benzodioxole-5-carbonyl]-benzylamino]phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 11657744 |
| Molecular Formula | C38H35F3N2O7S |
| Molecular Weight | 720.77 g/mol |
| Exact Mass | 720.21 |
| IUPAC Name | [2-[[(3aR,7aR)-6-[benzyl(phenyl)carbamoyl]-2,2-dimethyl-3a,4,7,7a-tetrahydro-1,3-benzodioxole-5-carbonyl]-benzylamino]phenyl] trifluoromethanesulfonate |
| SMILES | CC1(C)O[C@@H]2CC(C(=O)N(Cc3ccccc3)c3ccccc3)=C(C(=O)N(Cc3ccccc3)c3ccccc3OS(=O)(=O)C(F)(F)F)C[C@H]2O1 |
| InChI | InChI=1S/C38H35F3N2O7S/c1-37(2)48-33-22-29(35(44)42(28-18-10-5-11-19-28)24-26-14-6-3-7-15-26)30(23-34(33)49-37)36(45)43(25-27-16-8-4-9-17-27)31-20-12-13-21-32(31)50-51(46,47)38(39,40)41/h3-21,33-34H,22-25H2,1-2H3/t33-,34-/m1/s1 |
| InChIKey | WCFKOOZRRQUHGS-KKLWWLSJSA-N |
| XLogP | 7.29 |
| TPSA | 102.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.77 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|