C29H25F3N2O7S — CID 101369789
[2-[benzyl-[(Z)-2-(2'-oxospiro[1,3-dioxolane-2,3'-1H-indole]-7'-yl)pent-2-enoyl]amino]phenyl] trifluoromethanesulfonate (PubChem CID 101369789) has the molecular formula C29H25F3N2O7S and a molecular weight of 602.59 g/mol. Its IUPAC name is [2-[benzyl-[(Z)-2-(2'-oxospiro[1,3-dioxolane-2,3'-1H-indole]-7'-yl)pent-2-enoyl]amino]phenyl] trifluoromethanesulfonate.
| Compound Name | [2-[benzyl-[(Z)-2-(2'-oxospiro[1,3-dioxolane-2,3'-1H-indole]-7'-yl)pent-2-enoyl]amino]phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 101369789 |
| Molecular Formula | C29H25F3N2O7S |
| Molecular Weight | 602.59 g/mol |
| Exact Mass | 602.13 |
| IUPAC Name | [2-[benzyl-[(Z)-2-(2'-oxospiro[1,3-dioxolane-2,3'-1H-indole]-7'-yl)pent-2-enoyl]amino]phenyl] trifluoromethanesulfonate |
| SMILES | CC/C=C(\C(=O)N(Cc1ccccc1)c1ccccc1OS(=O)(=O)C(F)(F)F)c1cccc2c1NC(=O)C21OCCO1 |
| InChI | InChI=1S/C29H25F3N2O7S/c1-2-9-21(20-12-8-13-22-25(20)33-27(36)28(22)39-16-17-40-28)26(35)34(18-19-10-4-3-5-11-19)23-14-6-7-15-24(23)41-42(37,38)29(30,31)32/h3-15H,2,16-18H2,1H3,(H,33,36)/b21-9- |
| InChIKey | OYPATIXKCMSYOJ-NKVSQWTQSA-N |
| XLogP | 5.09 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.59 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|