C17H22F3NO4S — CID 166437462
[2-[methyl(2-methylideneoctanoyl)amino]phenyl] trifluoromethanesulfonate (PubChem CID 166437462) has the molecular formula C17H22F3NO4S and a molecular weight of 393.43 g/mol. Its IUPAC name is [2-[methyl(2-methylideneoctanoyl)amino]phenyl] trifluoromethanesulfonate.
| Compound Name | [2-[methyl(2-methylideneoctanoyl)amino]phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 166437462 |
| Molecular Formula | C17H22F3NO4S |
| Molecular Weight | 393.43 g/mol |
| Exact Mass | 393.12 |
| IUPAC Name | [2-[methyl(2-methylideneoctanoyl)amino]phenyl] trifluoromethanesulfonate |
| SMILES | C=C(CCCCCC)C(=O)N(C)c1ccccc1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C17H22F3NO4S/c1-4-5-6-7-10-13(2)16(22)21(3)14-11-8-9-12-15(14)25-26(23,24)17(18,19)20/h8-9,11-12H,2,4-7,10H2,1,3H3 |
| InChIKey | LFMORAPVONDWSL-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.43 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|