C17H23F3IO3S+ — CID 11734896
phenyl-[(E)-2-(trifluoromethylsulfonyloxy)dec-1-enyl]iodanium (PubChem CID 11734896) has the molecular formula C17H23F3IO3S+ and a molecular weight of 491.33 g/mol. Its IUPAC name is phenyl-[(E)-2-(trifluoromethylsulfonyloxy)dec-1-enyl]iodanium.
| Compound Name | phenyl-[(E)-2-(trifluoromethylsulfonyloxy)dec-1-enyl]iodanium |
|---|---|
| PubChem CID | 11734896 |
| Molecular Formula | C17H23F3IO3S+ |
| Molecular Weight | 491.33 g/mol |
| Exact Mass | 491.04 |
| IUPAC Name | phenyl-[(E)-2-(trifluoromethylsulfonyloxy)dec-1-enyl]iodanium |
| SMILES | CCCCCCCC/C(=C\[I+]c1ccccc1)OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C17H23F3IO3S/c1-2-3-4-5-6-10-13-16(24-25(22,23)17(18,19)20)14-21-15-11-8-7-9-12-15/h7-9,11-12,14H,2-6,10,13H2,1H3/q+1/b16-14+ |
| InChIKey | PXKDHBJYCMESTO-JQIJEIRASA-N |
| XLogP | 2.40 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.33 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|