About oct-3-en-4-yl trifluoromethanesulfonate
oct-3-en-4-yl trifluoromethanesulfonate (PubChem CID 150001053) has the molecular formula C9H15F3O3S
and a molecular weight of 260.28 g/mol. Its IUPAC name is oct-3-en-4-yl trifluoromethanesulfonate.
Molecular Properties
| Compound Name | oct-3-en-4-yl trifluoromethanesulfonate |
| PubChem CID | 150001053 |
| Molecular Formula | C9H15F3O3S |
| Molecular Weight | 260.28 g/mol |
| Exact Mass | 260.07 |
| IUPAC Name | oct-3-en-4-yl trifluoromethanesulfonate |
| SMILES | CCC=C(CCCC)OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C9H15F3O3S/c1-3-5-7-8(6-4-2)15-16(13,14)9(10,11)12/h6H,3-5,7H2,1-2H3 |
| InChIKey | DBHKWVIUGMSDMM-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.28 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze oct-3-en-4-yl trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oct-3-en-4-yl trifluoromethanesulfonate?
The IUPAC name of oct-3-en-4-yl trifluoromethanesulfonate (CID 150001053) is oct-3-en-4-yl trifluoromethanesulfonate.
What is the SMILES notation for oct-3-en-4-yl trifluoromethanesulfonate?
The canonical SMILES for oct-3-en-4-yl trifluoromethanesulfonate is CCC=C(CCCC)OS(=O)(=O)C(F)(F)F.
What is the InChIKey of oct-3-en-4-yl trifluoromethanesulfonate?
The InChIKey is DBHKWVIUGMSDMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15F3O3S/c1-3-5-7-8(6-4-2)15-16(13,14)9(10,11)12/h6H,3-5,7H2,1-2H3.
What are the key properties of oct-3-en-4-yl trifluoromethanesulfonate?
oct-3-en-4-yl trifluoromethanesulfonate has a molecular weight of 260.28 g/mol, XLogP of 3.34, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for oct-3-en-4-yl trifluoromethanesulfonate is sourced from PubChem (CID 150001053), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).