C16H19F6IO6S2 — CID 57372114
phenyl-[5-(trifluoromethylsulfonyloxy)oct-4-en-4-yl]iodanium;trifluoromethanesulfonate (PubChem CID 57372114) has the molecular formula C16H19F6IO6S2 and a molecular weight of 612.35 g/mol. Its IUPAC name is phenyl-[5-(trifluoromethylsulfonyloxy)oct-4-en-4-yl]iodanium;trifluoromethanesulfonate.
| Compound Name | phenyl-[5-(trifluoromethylsulfonyloxy)oct-4-en-4-yl]iodanium;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 57372114 |
| Molecular Formula | C16H19F6IO6S2 |
| Molecular Weight | 612.35 g/mol |
| Exact Mass | 611.96 |
| IUPAC Name | phenyl-[5-(trifluoromethylsulfonyloxy)oct-4-en-4-yl]iodanium;trifluoromethanesulfonate |
| SMILES | CCCC(OS(=O)(=O)C(F)(F)F)=C(CCC)[I+]c1ccccc1.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C15H19F3IO3S.CHF3O3S/c1-3-8-13(19-12-10-6-5-7-11-12)14(9-4-2)22-23(20,21)15(16,17)18;2-1(3,4)8(5,6)7/h5-7,10-11H,3-4,8-9H2,1-2H3;(H,5,6,7)/q+1;/p-1 |
| InChIKey | KRMQZYOBIGCNKP-UHFFFAOYSA-M |
| XLogP | 1.67 |
| TPSA | 100.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.35 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|