C14H15F3O5S — CID 57256420
2-benzyl-3-(trifluoromethylsulfonyloxy)hex-2-enoic acid (PubChem CID 57256420) has the molecular formula C14H15F3O5S and a molecular weight of 352.33 g/mol. Its IUPAC name is 2-benzyl-3-(trifluoromethylsulfonyloxy)hex-2-enoic acid.
| Compound Name | 2-benzyl-3-(trifluoromethylsulfonyloxy)hex-2-enoic acid |
|---|---|
| PubChem CID | 57256420 |
| Molecular Formula | C14H15F3O5S |
| Molecular Weight | 352.33 g/mol |
| Exact Mass | 352.06 |
| IUPAC Name | 2-benzyl-3-(trifluoromethylsulfonyloxy)hex-2-enoic acid |
| SMILES | CCCC(OS(=O)(=O)C(F)(F)F)=C(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C14H15F3O5S/c1-2-6-12(22-23(20,21)14(15,16)17)11(13(18)19)9-10-7-4-3-5-8-10/h3-5,7-8H,2,6,9H2,1H3,(H,18,19) |
| InChIKey | PXMSSBIYTTXJQC-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.33 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|