C20H40N2O6S — CID 173272268
azane;2-dodec-2-en-3-ylperoxyethylbenzene;sulfuric acid (PubChem CID 173272268) has the molecular formula C20H40N2O6S and a molecular weight of 436.62 g/mol. Its IUPAC name is azane;2-dodec-2-en-3-ylperoxyethylbenzene;sulfuric acid.
| Compound Name | azane;2-dodec-2-en-3-ylperoxyethylbenzene;sulfuric acid |
|---|---|
| PubChem CID | 173272268 |
| Molecular Formula | C20H40N2O6S |
| Molecular Weight | 436.62 g/mol |
| Exact Mass | 436.26 |
| IUPAC Name | azane;2-dodec-2-en-3-ylperoxyethylbenzene;sulfuric acid |
| SMILES | CC=C(CCCCCCCCC)OOCCc1ccccc1.N.N.O=S(=O)(O)O |
| InChI | InChI=1S/C20H32O2.2H3N.H2O4S/c1-3-5-6-7-8-9-13-16-20(4-2)22-21-18-17-19-14-11-10-12-15-19;;;1-5(2,3)4/h4,10-12,14-15H,3,5-9,13,16-18H2,1-2H3;2*1H3;(H2,1,2,3,4) |
| InChIKey | WGZQPIIDNXUJDM-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 163.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.62 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|