About acetaldehyde;oct-1-en-2-ol;propylbenzene
acetaldehyde;oct-1-en-2-ol;propylbenzene (PubChem CID 142058386) has the molecular formula C19H32O2
and a molecular weight of 292.46 g/mol. Its IUPAC name is acetaldehyde;oct-1-en-2-ol;propylbenzene.
Molecular Properties
| Compound Name | acetaldehyde;oct-1-en-2-ol;propylbenzene |
| PubChem CID | 142058386 |
| Molecular Formula | C19H32O2 |
| Molecular Weight | 292.46 g/mol |
| Exact Mass | 292.24 |
| IUPAC Name | acetaldehyde;oct-1-en-2-ol;propylbenzene |
| SMILES | C=C(O)CCCCCC.CC=O.CCCc1ccccc1 |
| InChI | InChI=1S/C9H12.C8H16O.C2H4O/c1-2-6-9-7-4-3-5-8-9;1-3-4-5-6-7-8(2)9;1-2-3/h3-5,7-8H,2,6H2,1H3;9H,2-7H2,1H3;2H,1H3 |
| InChIKey | LBYALAIIQSCSGS-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 292.46 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze acetaldehyde;oct-1-en-2-ol;propylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetaldehyde;oct-1-en-2-ol;propylbenzene?
The IUPAC name of acetaldehyde;oct-1-en-2-ol;propylbenzene (CID 142058386) is acetaldehyde;oct-1-en-2-ol;propylbenzene.
What is the SMILES notation for acetaldehyde;oct-1-en-2-ol;propylbenzene?
The canonical SMILES for acetaldehyde;oct-1-en-2-ol;propylbenzene is C=C(O)CCCCCC.CC=O.CCCc1ccccc1.
What is the InChIKey of acetaldehyde;oct-1-en-2-ol;propylbenzene?
The InChIKey is LBYALAIIQSCSGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12.C8H16O.C2H4O/c1-2-6-9-7-4-3-5-8-9;1-3-4-5-6-7-8(2)9;1-2-3/h3-5,7-8H,2,6H2,1H3;9H,2-7H2,1H3;2H,1H3.
What are the key properties of acetaldehyde;oct-1-en-2-ol;propylbenzene?
acetaldehyde;oct-1-en-2-ol;propylbenzene has a molecular weight of 292.46 g/mol, XLogP of 5.87, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetaldehyde;oct-1-en-2-ol;propylbenzene is sourced from PubChem (CID 142058386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).