C21H19F3N2O7S — CID 87627026
ethyl 10-oxo-11-phenylmethoxy-3-(trifluoromethylsulfonyloxy)-9,11-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxylate (PubChem CID 87627026) has the molecular formula C21H19F3N2O7S and a molecular weight of 500.45 g/mol. Its IUPAC name is ethyl 10-oxo-11-phenylmethoxy-3-(trifluoromethylsulfonyloxy)-9,11-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxylate.
| Compound Name | ethyl 10-oxo-11-phenylmethoxy-3-(trifluoromethylsulfonyloxy)-9,11-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxylate |
|---|---|
| PubChem CID | 87627026 |
| Molecular Formula | C21H19F3N2O7S |
| Molecular Weight | 500.45 g/mol |
| Exact Mass | 500.09 |
| IUPAC Name | ethyl 10-oxo-11-phenylmethoxy-3-(trifluoromethylsulfonyloxy)-9,11-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxylate |
| SMILES | CCOC(=O)C1c2cccc(OS(=O)(=O)C(F)(F)F)c2C2CN1C(=O)N2OCc1ccccc1 |
| InChI | InChI=1S/C21H19F3N2O7S/c1-2-31-19(27)18-14-9-6-10-16(33-34(29,30)21(22,23)24)17(14)15-11-25(18)20(28)26(15)32-12-13-7-4-3-5-8-13/h3-10,15,18H,2,11-12H2,1H3 |
| InChIKey | LVBOFBQONAASGD-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 102.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.45 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|