C16H14F3NO7S — CID 118430804
ethyl 6-oxo-1-phenylmethoxy-4-(trifluoromethylsulfonyloxy)pyridine-3-carboxylate (PubChem CID 118430804) has the molecular formula C16H14F3NO7S and a molecular weight of 421.35 g/mol. Its IUPAC name is ethyl 6-oxo-1-phenylmethoxy-4-(trifluoromethylsulfonyloxy)pyridine-3-carboxylate.
| Compound Name | ethyl 6-oxo-1-phenylmethoxy-4-(trifluoromethylsulfonyloxy)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 118430804 |
| Molecular Formula | C16H14F3NO7S |
| Molecular Weight | 421.35 g/mol |
| Exact Mass | 421.04 |
| IUPAC Name | ethyl 6-oxo-1-phenylmethoxy-4-(trifluoromethylsulfonyloxy)pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cn(OCc2ccccc2)c(=O)cc1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C16H14F3NO7S/c1-2-25-15(22)12-9-20(26-10-11-6-4-3-5-7-11)14(21)8-13(12)27-28(23,24)16(17,18)19/h3-9H,2,10H2,1H3 |
| InChIKey | KPSSWKGTCKWGTH-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 100.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.35 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|