C17H14F3NO8S — CID 170700107
methyl 1-(2-benzoyloxyethyl)-6-oxo-4-(trifluoromethylsulfonyloxy)pyridine-3-carboxylate (PubChem CID 170700107) has the molecular formula C17H14F3NO8S and a molecular weight of 449.36 g/mol. Its IUPAC name is methyl 1-(2-benzoyloxyethyl)-6-oxo-4-(trifluoromethylsulfonyloxy)pyridine-3-carboxylate.
| Compound Name | methyl 1-(2-benzoyloxyethyl)-6-oxo-4-(trifluoromethylsulfonyloxy)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 170700107 |
| Molecular Formula | C17H14F3NO8S |
| Molecular Weight | 449.36 g/mol |
| Exact Mass | 449.04 |
| IUPAC Name | methyl 1-(2-benzoyloxyethyl)-6-oxo-4-(trifluoromethylsulfonyloxy)pyridine-3-carboxylate |
| SMILES | COC(=O)c1cn(CCOC(=O)c2ccccc2)c(=O)cc1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C17H14F3NO8S/c1-27-16(24)12-10-21(7-8-28-15(23)11-5-3-2-4-6-11)14(22)9-13(12)29-30(25,26)17(18,19)20/h2-6,9-10H,7-8H2,1H3 |
| InChIKey | OOZNGKZGEVWXTA-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 117.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.36 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|