C13H12F3NO6S — CID 169321490
methyl 1-(1-bicyclo[1.1.1]pentanyl)-6-oxo-4-(trifluoromethylsulfonyloxy)pyridine-3-carboxylate (PubChem CID 169321490) has the molecular formula C13H12F3NO6S and a molecular weight of 367.30 g/mol. Its IUPAC name is methyl 1-(1-bicyclo[1.1.1]pentanyl)-6-oxo-4-(trifluoromethylsulfonyloxy)pyridine-3-carboxylate.
| Compound Name | methyl 1-(1-bicyclo[1.1.1]pentanyl)-6-oxo-4-(trifluoromethylsulfonyloxy)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 169321490 |
| Molecular Formula | C13H12F3NO6S |
| Molecular Weight | 367.30 g/mol |
| Exact Mass | 367.03 |
| IUPAC Name | methyl 1-(1-bicyclo[1.1.1]pentanyl)-6-oxo-4-(trifluoromethylsulfonyloxy)pyridine-3-carboxylate |
| SMILES | COC(=O)c1cn(C23CC(C2)C3)c(=O)cc1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C13H12F3NO6S/c1-22-11(19)8-6-17(12-3-7(4-12)5-12)10(18)2-9(8)23-24(20,21)13(14,15)16/h2,6-7H,3-5H2,1H3 |
| InChIKey | WSVHYRAUVROOPQ-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 91.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.30 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|