C18H19NO6S — CID 165386651
methyl 1-(1-methylcyclopropyl)-4-(4-methylphenyl)sulfonyloxy-6-oxopyridine-3-carboxylate (PubChem CID 165386651) has the molecular formula C18H19NO6S and a molecular weight of 377.42 g/mol. Its IUPAC name is methyl 1-(1-methylcyclopropyl)-4-(4-methylphenyl)sulfonyloxy-6-oxopyridine-3-carboxylate.
| Compound Name | methyl 1-(1-methylcyclopropyl)-4-(4-methylphenyl)sulfonyloxy-6-oxopyridine-3-carboxylate |
|---|---|
| PubChem CID | 165386651 |
| Molecular Formula | C18H19NO6S |
| Molecular Weight | 377.42 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | methyl 1-(1-methylcyclopropyl)-4-(4-methylphenyl)sulfonyloxy-6-oxopyridine-3-carboxylate |
| SMILES | COC(=O)c1cn(C2(C)CC2)c(=O)cc1OS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C18H19NO6S/c1-12-4-6-13(7-5-12)26(22,23)25-15-10-16(20)19(18(2)8-9-18)11-14(15)17(21)24-3/h4-7,10-11H,8-9H2,1-3H3 |
| InChIKey | BKWBZXXGMBEMEC-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 91.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.42 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|