C17H17N3O6S — CID 2785868
(1,3,8-trimethyl-2,4,7-trioxopyrido[2,3-d]pyrimidin-5-yl) 4-methylbenzenesulfonate (PubChem CID 2785868) has the molecular formula C17H17N3O6S and a molecular weight of 391.41 g/mol. Its IUPAC name is (1,3,8-trimethyl-2,4,7-trioxopyrido[2,3-d]pyrimidin-5-yl) 4-methylbenzenesulfonate.
| Compound Name | (1,3,8-trimethyl-2,4,7-trioxopyrido[2,3-d]pyrimidin-5-yl) 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 2785868 |
| Molecular Formula | C17H17N3O6S |
| Molecular Weight | 391.41 g/mol |
| Exact Mass | 391.08 |
| IUPAC Name | (1,3,8-trimethyl-2,4,7-trioxopyrido[2,3-d]pyrimidin-5-yl) 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)Oc2cc(=O)n(C)c3c2c(=O)n(C)c(=O)n3C)cc1 |
| InChI | InChI=1S/C17H17N3O6S/c1-10-5-7-11(8-6-10)27(24,25)26-12-9-13(21)18(2)15-14(12)16(22)20(4)17(23)19(15)3/h5-9H,1-4H3 |
| InChIKey | NNYGUGJEFATVAH-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 109.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.41 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|