C19H21N3O5S — CID 19071387
(1,3-diethyl-7-methyl-2,4-dioxopyrido[2,3-d]pyrimidin-5-yl) 4-methylbenzenesulfonate (PubChem CID 19071387) has the molecular formula C19H21N3O5S and a molecular weight of 403.46 g/mol. Its IUPAC name is (1,3-diethyl-7-methyl-2,4-dioxopyrido[2,3-d]pyrimidin-5-yl) 4-methylbenzenesulfonate.
| Compound Name | (1,3-diethyl-7-methyl-2,4-dioxopyrido[2,3-d]pyrimidin-5-yl) 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 19071387 |
| Molecular Formula | C19H21N3O5S |
| Molecular Weight | 403.46 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | (1,3-diethyl-7-methyl-2,4-dioxopyrido[2,3-d]pyrimidin-5-yl) 4-methylbenzenesulfonate |
| SMILES | CCn1c(=O)c2c(OS(=O)(=O)c3ccc(C)cc3)cc(C)nc2n(CC)c1=O |
| InChI | InChI=1S/C19H21N3O5S/c1-5-21-17-16(18(23)22(6-2)19(21)24)15(11-13(4)20-17)27-28(25,26)14-9-7-12(3)8-10-14/h7-11H,5-6H2,1-4H3 |
| InChIKey | BCDSVSPPHSETSX-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 100.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.46 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|